About 3-iodo-2,4,7-trimethyl-5-propylphenanthrene
3-iodo-2,4,7-trimethyl-5-propylphenanthrene (PubChem CID 90296600) has the molecular formula C20H21I
and a molecular weight of 388.29 g/mol. Its IUPAC name is 3-iodo-2,4,7-trimethyl-5-propylphenanthrene.
Molecular Properties
| Compound Name | 3-iodo-2,4,7-trimethyl-5-propylphenanthrene |
| PubChem CID | 90296600 |
| Molecular Formula | C20H21I |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-iodo-2,4,7-trimethyl-5-propylphenanthrene |
| SMILES | CCCc1cc(C)cc2ccc3cc(C)c(I)c(C)c3c12 |
| InChI | InChI=1S/C20H21I/c1-5-6-15-9-12(2)10-16-7-8-17-11-13(3)20(21)14(4)18(17)19(15)16/h7-11H,5-6H2,1-4H3 |
| InChIKey | KXIHKYCIXGJAGM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2,4,7-trimethyl-5-propylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2,4,7-trimethyl-5-propylphenanthrene?
The IUPAC name of 3-iodo-2,4,7-trimethyl-5-propylphenanthrene (CID 90296600) is 3-iodo-2,4,7-trimethyl-5-propylphenanthrene.
What is the SMILES notation for 3-iodo-2,4,7-trimethyl-5-propylphenanthrene?
The canonical SMILES for 3-iodo-2,4,7-trimethyl-5-propylphenanthrene is CCCc1cc(C)cc2ccc3cc(C)c(I)c(C)c3c12.
What is the InChIKey of 3-iodo-2,4,7-trimethyl-5-propylphenanthrene?
The InChIKey is KXIHKYCIXGJAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21I/c1-5-6-15-9-12(2)10-16-7-8-17-11-13(3)20(21)14(4)18(17)19(15)16/h7-11H,5-6H2,1-4H3.
What are the key properties of 3-iodo-2,4,7-trimethyl-5-propylphenanthrene?
3-iodo-2,4,7-trimethyl-5-propylphenanthrene has a molecular weight of 388.29 g/mol, XLogP of 6.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2,4,7-trimethyl-5-propylphenanthrene is sourced from PubChem (CID 90296600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).