C18H23F3O3 — CID 90296769
[(2S)-6-methylhept-5-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 90296769) has the molecular formula C18H23F3O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is [(2S)-6-methylhept-5-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S)-6-methylhept-5-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 90296769 |
| Molecular Formula | C18H23F3O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [(2S)-6-methylhept-5-en-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@@H](C)CCC=C(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O3/c1-13(2)9-8-10-14(3)24-16(22)17(23-4,18(19,20)21)15-11-6-5-7-12-15/h5-7,9,11-12,14H,8,10H2,1-4H3/t14-,17+/m0/s1 |
| InChIKey | YVKWFCGFICHGBO-WMLDXEAASA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|