C13H20N2O8 — CID 90296823
3-(2,5-dioxopyrrol-1-yl)-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide (PubChem CID 90296823) has the molecular formula C13H20N2O8 and a molecular weight of 332.31 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 90296823 |
| Molecular Formula | C13H20N2O8 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H20N2O8/c16-6-8(18)13(23)12(22)7(17)5-14-9(19)3-4-15-10(20)1-2-11(15)21/h1-2,7-8,12-13,16-18,22-23H,3-6H2,(H,14,19)/t7-,8-,12-,13-/m1/s1 |
| InChIKey | DAVONISNTZWZJR-QEJJIEOJSA-N |
| XLogP | -4.15 |
| TPSA | 167.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|