C28H60O6Si — CID 90296836
(2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-8-[hydroxy(dimethyl)silyl]-8-methylnonan-1-ol (PubChem CID 90296836) has the molecular formula C28H60O6Si and a molecular weight of 520.87 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-8-[hydroxy(dimethyl)silyl]-8-methylnonan-1-ol.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-8-[hydroxy(dimethyl)silyl]-8-methylnonan-1-ol |
|---|---|
| PubChem CID | 90296836 |
| Molecular Formula | C28H60O6Si |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 520.42 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-8-[hydroxy(dimethyl)silyl]-8-methylnonan-1-ol |
| SMILES | CCCCO[C@@H]([C@H](OCCCC)[C@@H](CCC(C)(C)[Si](C)(C)O)OCCCC)[C@@H](CO)OCCCC |
| InChI | InChI=1S/C28H60O6Si/c1-9-13-19-31-24(17-18-28(5,6)35(7,8)30)26(33-21-15-11-3)27(34-22-16-12-4)25(23-29)32-20-14-10-2/h24-27,29-30H,9-23H2,1-8H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | UIRLLUVDCGNGIA-FPCALVHFSA-N |
| XLogP | 6.48 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|