C19H30O10 — CID 90296897
[(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-7-methyloctyl] acetate (PubChem CID 90296897) has the molecular formula C19H30O10 and a molecular weight of 418.44 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-7-methyloctyl] acetate.
| Compound Name | [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-7-methyloctyl] acetate |
|---|---|
| PubChem CID | 90296897 |
| Molecular Formula | C19H30O10 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-7-methyloctyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](CC(C)C)OC(C)=O |
| InChI | InChI=1S/C19H30O10/c1-10(2)8-16(26-12(4)21)18(28-14(6)23)19(29-15(7)24)17(27-13(5)22)9-25-11(3)20/h10,16-19H,8-9H2,1-7H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | MSJGDFRPDNDUGW-XWSJACJDSA-N |
| XLogP | 1.32 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|