C26H54O5 — CID 90296930
1-(5-hydroxy-7-methoxy-2,4,4,6,6-pentamethylheptan-2-yl)oxy-6-methoxy-2,2,4,4,6-pentamethylheptan-3-ol (PubChem CID 90296930) has the molecular formula C26H54O5 and a molecular weight of 446.71 g/mol. Its IUPAC name is 1-(5-hydroxy-7-methoxy-2,4,4,6,6-pentamethylheptan-2-yl)oxy-6-methoxy-2,2,4,4,6-pentamethylheptan-3-ol.
| Compound Name | 1-(5-hydroxy-7-methoxy-2,4,4,6,6-pentamethylheptan-2-yl)oxy-6-methoxy-2,2,4,4,6-pentamethylheptan-3-ol |
|---|---|
| PubChem CID | 90296930 |
| Molecular Formula | C26H54O5 |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.40 |
| IUPAC Name | 1-(5-hydroxy-7-methoxy-2,4,4,6,6-pentamethylheptan-2-yl)oxy-6-methoxy-2,2,4,4,6-pentamethylheptan-3-ol |
| SMILES | COCC(C)(C)C(O)C(C)(C)CC(C)(C)OCC(C)(C)C(O)C(C)(C)CC(C)(C)OC |
| InChI | InChI=1S/C26H54O5/c1-21(2,15-25(9,10)30-14)20(28)24(7,8)18-31-26(11,12)16-22(3,4)19(27)23(5,6)17-29-13/h19-20,27-28H,15-18H2,1-14H3 |
| InChIKey | DOLDSHMJBPICGD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |