C30H35B2NO4 — CID 90297524
9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 90297524) has the molecular formula C30H35B2NO4 and a molecular weight of 495.24 g/mol. Its IUPAC name is 9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 90297524 |
| Molecular Formula | C30H35B2NO4 |
| Molecular Weight | 495.24 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 9-phenyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC1(C)OB(c2ccc3c4ccc(B5OC(C)(C)C(C)(C)O5)cc4n(-c4ccccc4)c3c2)OC1(C)C |
| InChI | InChI=1S/C30H35B2NO4/c1-27(2)28(3,4)35-31(34-27)20-14-16-23-24-17-15-21(32-36-29(5,6)30(7,8)37-32)19-26(24)33(25(23)18-20)22-12-10-9-11-13-22/h9-19H,1-8H3 |
| InChIKey | BLKLIQJTGNDTOL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|