C17H22BO2 — CID 90297885
CID 90297885 (PubChem CID 90297885) has the molecular formula C17H22BO2 and a molecular weight of 269.17 g/mol.
| Compound Name | CID 90297885 |
|---|---|
| PubChem CID | 90297885 |
| Molecular Formula | C17H22BO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cc([B]OC(C)(C)C(C)(C)O)ccc2c1 |
| InChI | InChI=1S/C17H22BO2/c1-12-6-7-14-11-15(9-8-13(14)10-12)18-20-17(4,5)16(2,3)19/h6-11,19H,1-5H3 |
| InChIKey | LGDQIYFOWKAVGL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|