C32H36B2ClFN2O5S — CID 90298144
6-(2-chloro-1,3-thiazol-5-yl)-12-ethyl-1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazine (PubChem CID 90298144) has the molecular formula C32H36B2ClFN2O5S and a molecular weight of 636.79 g/mol. Its IUPAC name is 6-(2-chloro-1,3-thiazol-5-yl)-12-ethyl-1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazine.
| Compound Name | 6-(2-chloro-1,3-thiazol-5-yl)-12-ethyl-1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 90298144 |
| Molecular Formula | C32H36B2ClFN2O5S |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 6-(2-chloro-1,3-thiazol-5-yl)-12-ethyl-1-fluoro-3,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazine |
| SMILES | CCc1c2n(c3ccc(B4OC(C)(C)C(C)(C)O4)cc13)C(c1cnc(Cl)s1)Oc1cc(B3OC(C)(C)C(C)(C)O3)cc(F)c1-2 |
| InChI | InChI=1S/C32H36B2ClFN2O5S/c1-10-19-20-13-17(33-40-29(2,3)30(4,5)41-33)11-12-22(20)38-26(19)25-21(36)14-18(34-42-31(6,7)32(8,9)43-34)15-23(25)39-27(38)24-16-37-28(35)44-24/h11-16,27H,10H2,1-9H3 |
| InChIKey | IWTJSPNUPXIVMH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|