About [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate
[(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate (PubChem CID 90298876) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate |
| PubChem CID | 90298876 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate |
| SMILES | C#Cc1cnn(C)c1NC(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O2/c1-4-12-10-16-18(3)14(12)17-15(19)20-11(2)13-8-6-5-7-9-13/h1,5-11H,2-3H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | KYRVZAYXHOZFTM-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate?
The IUPAC name of [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate (CID 90298876) is [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate.
What is the SMILES notation for [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate?
The canonical SMILES for [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate is C#Cc1cnn(C)c1NC(=O)O[C@H](C)c1ccccc1.
What is the InChIKey of [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate?
The InChIKey is KYRVZAYXHOZFTM-LLVKDONJSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-4-12-10-16-18(3)14(12)17-15(19)20-11(2)13-8-6-5-7-9-13/h1,5-11H,2-3H3,(H,17,19)/t11-/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate?
[(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate has a molecular weight of 269.30 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] N-(4-ethynyl-1-methylpyrazol-5-yl)carbamate is sourced from PubChem (CID 90298876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).