About 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine
5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine (PubChem CID 90299134) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine |
| PubChem CID | 90299134 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine |
| SMILES | C/C=C\n1nc(C)nc1N |
| InChI | InChI=1S/C6H10N4/c1-3-4-10-6(7)8-5(2)9-10/h3-4H,1-2H3,(H2,7,8,9)/b4-3- |
| InChIKey | DEPOZZKIRPONNZ-ARJAWSKDSA-N |
| XLogP | 0.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine?
The IUPAC name of 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine (CID 90299134) is 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine?
The canonical SMILES for 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine is C/C=C\n1nc(C)nc1N.
What is the InChIKey of 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine?
The InChIKey is DEPOZZKIRPONNZ-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H10N4/c1-3-4-10-6(7)8-5(2)9-10/h3-4H,1-2H3,(H2,7,8,9)/b4-3-.
What are the key properties of 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine?
5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine has a molecular weight of 138.17 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 90299134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).