C9H4F6O4S — CID 90299388
[thiophen-2-yl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate (PubChem CID 90299388) has the molecular formula C9H4F6O4S and a molecular weight of 322.18 g/mol. Its IUPAC name is [thiophen-2-yl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate.
| Compound Name | [thiophen-2-yl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90299388 |
| Molecular Formula | C9H4F6O4S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | [thiophen-2-yl-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(OC(=O)C(F)(F)F)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C9H4F6O4S/c10-8(11,12)6(16)18-5(4-2-1-3-20-4)19-7(17)9(13,14)15/h1-3,5H |
| InChIKey | XKLDBLGUHCYGII-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|