About [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol
[(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol (PubChem CID 90299503) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol |
| PubChem CID | 90299503 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol |
| SMILES | OCC1=CC[C@H](C2CC2)S1 |
| InChI | InChI=1S/C8H12OS/c9-5-7-3-4-8(10-7)6-1-2-6/h3,6,8-9H,1-2,4-5H2/t8-/m1/s1 |
| InChIKey | HACIEDKEDUEASL-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol?
The IUPAC name of [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol (CID 90299503) is [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol.
What is the SMILES notation for [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol?
The canonical SMILES for [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol is OCC1=CC[C@H](C2CC2)S1.
What is the InChIKey of [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol?
The InChIKey is HACIEDKEDUEASL-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12OS/c9-5-7-3-4-8(10-7)6-1-2-6/h3,6,8-9H,1-2,4-5H2/t8-/m1/s1.
What are the key properties of [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol?
[(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol has a molecular weight of 156.25 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-cyclopropyl-2,3-dihydrothiophen-5-yl]methanol is sourced from PubChem (CID 90299503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).