C11H22O — CID 90299782
(E,3R)-2,3,6-trimethyloct-4-en-2-ol (PubChem CID 90299782) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (E,3R)-2,3,6-trimethyloct-4-en-2-ol.
| Compound Name | (E,3R)-2,3,6-trimethyloct-4-en-2-ol |
|---|---|
| PubChem CID | 90299782 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (E,3R)-2,3,6-trimethyloct-4-en-2-ol |
| SMILES | CCC(C)/C=C/[C@@H](C)C(C)(C)O |
| InChI | InChI=1S/C11H22O/c1-6-9(2)7-8-10(3)11(4,5)12/h7-10,12H,6H2,1-5H3/b8-7+/t9?,10-/m1/s1 |
| InChIKey | MYRPKNNIOBONTE-ZCUDWALESA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|