About (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide
(2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide (PubChem CID 90299785) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide |
| PubChem CID | 90299785 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](NC(O)OC)C(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-5(2)6(7(11)9-3)10-8(12)13-4/h5-6,8,10,12H,1-4H3,(H,9,11)/t6-,8?/m0/s1 |
| InChIKey | VQXYDZUDSWQEJO-UUEFVBAFSA-N |
| XLogP | -0.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide?
The IUPAC name of (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide (CID 90299785) is (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide.
What is the SMILES notation for (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide?
The canonical SMILES for (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide is CNC(=O)[C@@H](NC(O)OC)C(C)C.
What is the InChIKey of (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide?
The InChIKey is VQXYDZUDSWQEJO-UUEFVBAFSA-N. The full InChI is InChI=1S/C8H18N2O3/c1-5(2)6(7(11)9-3)10-8(12)13-4/h5-6,8,10,12H,1-4H3,(H,9,11)/t6-,8?/m0/s1.
What are the key properties of (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide?
(2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide has a molecular weight of 190.24 g/mol, XLogP of -0.73, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[hydroxy(methoxy)methyl]amino]-N,3-dimethylbutanamide is sourced from PubChem (CID 90299785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).