C8H13N3O2 — CID 90300003
(3R,4S,5R)-3-azido-5-ethyl-3,4-dimethyloxolan-2-one (PubChem CID 90300003) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3R,4S,5R)-3-azido-5-ethyl-3,4-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5R)-3-azido-5-ethyl-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 90300003 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (3R,4S,5R)-3-azido-5-ethyl-3,4-dimethyloxolan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@](C)(N=[N+]=[N-])[C@@H]1C |
| InChI | InChI=1S/C8H13N3O2/c1-4-6-5(2)8(3,10-11-9)7(12)13-6/h5-6H,4H2,1-3H3/t5-,6-,8-/m1/s1 |
| InChIKey | ZRISSWUSMFUORR-ATRFCDNQSA-N |
| XLogP | 2.03 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|