About 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran
4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran (PubChem CID 90300199) has the molecular formula C9H13ClO
and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran |
| PubChem CID | 90300199 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran |
| SMILES | CC1=C(/C=C(\C)Cl)C(C)CO1 |
| InChI | InChI=1S/C9H13ClO/c1-6-5-11-8(3)9(6)4-7(2)10/h4,6H,5H2,1-3H3/b7-4+ |
| InChIKey | HNLCZDLYPPIUAV-QPJJXVBHSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran?
The IUPAC name of 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran (CID 90300199) is 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran.
What is the SMILES notation for 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran?
The canonical SMILES for 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran is CC1=C(/C=C(\C)Cl)C(C)CO1.
What is the InChIKey of 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran?
The InChIKey is HNLCZDLYPPIUAV-QPJJXVBHSA-N. The full InChI is InChI=1S/C9H13ClO/c1-6-5-11-8(3)9(6)4-7(2)10/h4,6H,5H2,1-3H3/b7-4+.
What are the key properties of 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran?
4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran has a molecular weight of 172.66 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-chloroprop-1-enyl]-3,5-dimethyl-2,3-dihydrofuran is sourced from PubChem (CID 90300199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).