C26H38IN3O8S — CID 90301451
[(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-(2,4,4-trimethylpentan-2-yloxycarbonyl)carbamic acid (PubChem CID 90301451) has the molecular formula C26H38IN3O8S and a molecular weight of 679.57 g/mol. Its IUPAC name is [(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-(2,4,4-trimethylpentan-2-yloxycarbonyl)carbamic acid.
| Compound Name | [(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-(2,4,4-trimethylpentan-2-yloxycarbonyl)carbamic acid |
|---|---|
| PubChem CID | 90301451 |
| Molecular Formula | C26H38IN3O8S |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | [(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-(2,4,4-trimethylpentan-2-yloxycarbonyl)carbamic acid |
| SMILES | CC(C)(C)CC(C)(C)OC(=O)N(C(=O)O)C1=N[C@](C)(c2cc([N+](=O)[O-])ccc2CCCI)CS(=O)(=O)C1(C)C |
| InChI | InChI=1S/C26H38IN3O8S/c1-23(2,3)15-24(4,5)38-22(33)29(21(31)32)20-25(6,7)39(36,37)16-26(8,28-20)19-14-18(30(34)35)12-11-17(19)10-9-13-27/h11-12,14H,9-10,13,15-16H2,1-8H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | ZOCHBVYEJHIHOI-SANMLTNESA-N |
| XLogP | 6.11 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|