C23H32N4O2 — CID 9030159
(2R)-2-[[4-(dimethylamino)phenyl]methyl-methylamino]-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide (PubChem CID 9030159) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (2R)-2-[[4-(dimethylamino)phenyl]methyl-methylamino]-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide.
| Compound Name | (2R)-2-[[4-(dimethylamino)phenyl]methyl-methylamino]-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 9030159 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (2R)-2-[[4-(dimethylamino)phenyl]methyl-methylamino]-N-[2-(2,6-dimethylanilino)-2-oxoethyl]propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)[C@@H](C)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H32N4O2/c1-16-8-7-9-17(2)22(16)25-21(28)14-24-23(29)18(3)27(6)15-19-10-12-20(13-11-19)26(4)5/h7-13,18H,14-15H2,1-6H3,(H,24,29)(H,25,28)/t18-/m1/s1 |
| InChIKey | DJXBDYADYCKELX-GOSISDBHSA-N |
| XLogP | 2.94 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|