C19H21ClFN3O2 — CID 90301768
N-[(1S)-1-[4-[1-(2-chloro-3-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide (PubChem CID 90301768) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is N-[(1S)-1-[4-[1-(2-chloro-3-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[4-[1-(2-chloro-3-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 90301768 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[(1S)-1-[4-[1-(2-chloro-3-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1ccc(OC2CCN(c3ccnc(Cl)c3F)C2)cc1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-12(23-13(2)25)14-3-5-15(6-4-14)26-16-8-10-24(11-16)17-7-9-22-19(20)18(17)21/h3-7,9,12,16H,8,10-11H2,1-2H3,(H,23,25)/t12-,16?/m0/s1 |
| InChIKey | MIEDAIIAGNBAMT-HKALDPMFSA-N |
| XLogP | 3.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|