About [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate
[dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate (PubChem CID 90301898) has the molecular formula C15H28O9Si2
and a molecular weight of 408.55 g/mol. Its IUPAC name is [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate.
Molecular Properties
| Compound Name | [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate |
| PubChem CID | 90301898 |
| Molecular Formula | C15H28O9Si2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate |
| SMILES | C=CC(=O)OC(CC[Si](OC)(OC)OC)C(=C)C(=O)O[Si](C)(OC)OC |
| InChI | InChI=1S/C15H28O9Si2/c1-9-14(16)23-13(10-11-26(20-5,21-6)22-7)12(2)15(17)24-25(8,18-3)19-4/h9,13H,1-2,10-11H2,3-8H3 |
| InChIKey | UYKSBSGCXQZABP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate?
The IUPAC name of [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate (CID 90301898) is [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate.
What is the SMILES notation for [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate?
The canonical SMILES for [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate is C=CC(=O)OC(CC[Si](OC)(OC)OC)C(=C)C(=O)O[Si](C)(OC)OC.
What is the InChIKey of [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate?
The InChIKey is UYKSBSGCXQZABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O9Si2/c1-9-14(16)23-13(10-11-26(20-5,21-6)22-7)12(2)15(17)24-25(8,18-3)19-4/h9,13H,1-2,10-11H2,3-8H3.
What are the key properties of [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate?
[dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate has a molecular weight of 408.55 g/mol, XLogP of 1.31, 13 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethoxy(methyl)silyl] 2-methylidene-3-prop-2-enoyloxy-5-trimethoxysilylpentanoate is sourced from PubChem (CID 90301898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).