C39H32F3N4O3S+ — CID 90303028
benzyl-[(4S,6S)-4-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium (PubChem CID 90303028) has the molecular formula C39H32F3N4O3S+ and a molecular weight of 693.77 g/mol. Its IUPAC name is benzyl-[(4S,6S)-4-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium.
| Compound Name | benzyl-[(4S,6S)-4-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium |
|---|---|
| PubChem CID | 90303028 |
| Molecular Formula | C39H32F3N4O3S+ |
| Molecular Weight | 693.77 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | benzyl-[(4S,6S)-4-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium |
| SMILES | COc1ccc([N+](Cc2ccccc2)(C2=N[C@](C)(c3cc(C#Cc4ccc(C#N)cn4)cs3)C[C@@H](C(F)(F)F)O2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H32F3N4O3S/c1-38(36-21-28(26-50-36)9-11-30-12-10-29(23-43)24-44-30)22-35(39(40,41)42)49-37(45-38)46(25-27-7-5-4-6-8-27,31-13-17-33(47-2)18-14-31)32-15-19-34(48-3)20-16-32/h4-8,10,12-21,24,26,35H,22,25H2,1-3H3/q+1/t35-,38-/m0/s1 |
| InChIKey | AOBKFZMYFFUMHE-LFGICVIVSA-N |
| XLogP | 8.89 |
| TPSA | 76.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.77 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|