C39H34FN4O3S+ — CID 90303323
benzyl-[(4S,6S)-6-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-(fluoromethyl)-6-methyl-4,5-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium (PubChem CID 90303323) has the molecular formula C39H34FN4O3S+ and a molecular weight of 657.79 g/mol. Its IUPAC name is benzyl-[(4S,6S)-6-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-(fluoromethyl)-6-methyl-4,5-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium.
| Compound Name | benzyl-[(4S,6S)-6-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-(fluoromethyl)-6-methyl-4,5-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium |
|---|---|
| PubChem CID | 90303323 |
| Molecular Formula | C39H34FN4O3S+ |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | benzyl-[(4S,6S)-6-[4-[2-(5-cyano-2-pyridinyl)ethynyl]thiophen-2-yl]-4-(fluoromethyl)-6-methyl-4,5-dihydro-1,3-oxazin-2-yl]-bis(4-methoxyphenyl)azanium |
| SMILES | COc1ccc([N+](Cc2ccccc2)(C2=N[C@H](CF)C[C@@](C)(c3cc(C#Cc4ccc(C#N)cn4)cs3)O2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H34FN4O3S/c1-39(37-21-29(27-48-37)9-11-31-12-10-30(24-41)25-42-31)22-32(23-40)43-38(47-39)44(26-28-7-5-4-6-8-28,33-13-17-35(45-2)18-14-33)34-15-19-36(46-3)20-16-34/h4-8,10,12-21,25,27,32H,22-23,26H2,1-3H3/q+1/t32-,39-/m0/s1 |
| InChIKey | ZSUKMPMRHULRMU-GSSDHLSPSA-N |
| XLogP | 8.30 |
| TPSA | 76.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|