About N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine
N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine (PubChem CID 90303688) has the molecular formula C9H13Cl2N3
and a molecular weight of 234.13 g/mol. Its IUPAC name is N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine |
| PubChem CID | 90303688 |
| Molecular Formula | C9H13Cl2N3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine |
| SMILES | CN(c1cc(Cl)nc(Cl)n1)C(C)(C)C |
| InChI | InChI=1S/C9H13Cl2N3/c1-9(2,3)14(4)7-5-6(10)12-8(11)13-7/h5H,1-4H3 |
| InChIKey | LEVJKENYGZKMMV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine?
The IUPAC name of N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine (CID 90303688) is N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine.
What is the SMILES notation for N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine?
The canonical SMILES for N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine is CN(c1cc(Cl)nc(Cl)n1)C(C)(C)C.
What is the InChIKey of N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine?
The InChIKey is LEVJKENYGZKMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl2N3/c1-9(2,3)14(4)7-5-6(10)12-8(11)13-7/h5H,1-4H3.
What are the key properties of N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine?
N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine has a molecular weight of 234.13 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,6-dichloro-N-methylpyrimidin-4-amine is sourced from PubChem (CID 90303688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).