About 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde
2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde (PubChem CID 90303730) has the molecular formula C13H7ClF2O2
and a molecular weight of 268.65 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde |
| PubChem CID | 90303730 |
| Molecular Formula | C13H7ClF2O2 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)cc(F)c1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H7ClF2O2/c14-9-2-1-3-11(5-9)18-13-8(7-17)4-10(15)6-12(13)16/h1-7H |
| InChIKey | KFSODAZMWSTYGK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde?
The IUPAC name of 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde (CID 90303730) is 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde.
What is the SMILES notation for 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde?
The canonical SMILES for 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde is O=Cc1cc(F)cc(F)c1Oc1cccc(Cl)c1.
What is the InChIKey of 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde?
The InChIKey is KFSODAZMWSTYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClF2O2/c14-9-2-1-3-11(5-9)18-13-8(7-17)4-10(15)6-12(13)16/h1-7H.
What are the key properties of 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde?
2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde has a molecular weight of 268.65 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenoxy)-3,5-difluorobenzaldehyde is sourced from PubChem (CID 90303730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).