6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid

C9H10N2O2 — CID 90303788

IUPAC6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid
SMILESO=C(O)N1C=CN2CCC=CC2=C1
InChIInChI=1S/C9H10N2O2/c12-9(13)11-6-5-10-4-2-1-3-8(10)7-11/h1,3,5-7H,2,4H2,(H,12,13)
InChIKeyIWVABZLMCJOJLP-UHFFFAOYSA-N
MW178.19 g/mol
LogP1.55
Rot. Bonds

About 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid

6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid (PubChem CID 90303788) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid
PubChem CID90303788
Molecular FormulaC9H10N2O2
Molecular Weight178.19 g/mol
Exact Mass178.07
IUPAC Name6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid
SMILESO=C(O)N1C=CN2CCC=CC2=C1
InChIInChI=1S/C9H10N2O2/c12-9(13)11-6-5-10-4-2-1-3-8(10)7-11/h1,3,5-7H,2,4H2,(H,12,13)
InChIKeyIWVABZLMCJOJLP-UHFFFAOYSA-N
XLogP1.55
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid?
The IUPAC name of 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid (CID 90303788) is 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid.
What is the SMILES notation for 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid?
The canonical SMILES for 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid is O=C(O)N1C=CN2CCC=CC2=C1.
What is the InChIKey of 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid?
The InChIKey is IWVABZLMCJOJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-9(13)11-6-5-10-4-2-1-3-8(10)7-11/h1,3,5-7H,2,4H2,(H,12,13).
What are the key properties of 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid?
6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydropyrido[1,2-a]pyrazine-2-carboxylic acid is sourced from PubChem (CID 90303788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).