C34H33F3N7O4+ — CID 90303861
benzyl 5-[4-amino-3-[4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-2-(methoxymethyl)piperidine-1-carboxylate (PubChem CID 90303861) has the molecular formula C34H33F3N7O4+ and a molecular weight of 660.68 g/mol. Its IUPAC name is benzyl 5-[4-amino-3-[4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-2-(methoxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 5-[4-amino-3-[4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-2-(methoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90303861 |
| Molecular Formula | C34H33F3N7O4+ |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | benzyl 5-[4-amino-3-[4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-4-ium-1-yl]-2-(methoxymethyl)piperidine-1-carboxylate |
| SMILES | COCC1CCC(C2=C3C=NC=C[N+]3(N)C(c3ccc(C(=O)Nc4cc(C(F)(F)F)ccn4)cc3)=N2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H32F3N7O4/c1-47-21-27-12-11-25(19-43(27)33(46)48-20-22-5-3-2-4-6-22)30-28-18-39-15-16-44(28,38)31(42-30)23-7-9-24(10-8-23)32(45)41-29-17-26(13-14-40-29)34(35,36)37/h2-10,13-18,25,27H,11-12,19-21,38H2,1H3/p+1 |
| InChIKey | WDJJEFRAMOCADY-UHFFFAOYSA-O |
| XLogP | 5.63 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|