C20H15ClF4N4O2 — CID 90303897
(4S,6S)-4-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 90303897) has the molecular formula C20H15ClF4N4O2 and a molecular weight of 454.81 g/mol. Its IUPAC name is (4S,6S)-4-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4S,6S)-4-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 90303897 |
| Molecular Formula | C20H15ClF4N4O2 |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (4S,6S)-4-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | C[C@@]1(c2cc(-c3nnc(-c4ccc(Cl)cc4)o3)ccc2F)C[C@@H](C(F)(F)F)OC(N)=N1 |
| InChI | InChI=1S/C20H15ClF4N4O2/c1-19(9-15(20(23,24)25)30-18(26)27-19)13-8-11(4-7-14(13)22)17-29-28-16(31-17)10-2-5-12(21)6-3-10/h2-8,15H,9H2,1H3,(H2,26,27)/t15-,19-/m0/s1 |
| InChIKey | HXMSUEGPWIWPCC-KXBFYZLASA-N |
| XLogP | 5.08 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |