C42H40Cl4F2N12O6 — CID 90304018
bis[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrazin-2-yl]amino] oxalate (PubChem CID 90304018) has the molecular formula C42H40Cl4F2N12O6 and a molecular weight of 988.67 g/mol. Its IUPAC name is bis[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrazin-2-yl]amino] oxalate.
| Compound Name | bis[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrazin-2-yl]amino] oxalate |
|---|---|
| PubChem CID | 90304018 |
| Molecular Formula | C42H40Cl4F2N12O6 |
| Molecular Weight | 988.67 g/mol |
| Exact Mass | 986.19 |
| IUPAC Name | bis[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)pyrazin-2-yl]amino] oxalate |
| SMILES | C[C@@H](Oc1nc(-c2cnn(C3CCNCC3)c2)cnc1NOC(=O)C(=O)ONc1ncc(-c2cnn(C3CCNCC3)c2)nc1O[C@H](C)c1c(Cl)ccc(F)c1Cl)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C42H40Cl4F2N12O6/c1-21(33-27(43)3-5-29(47)35(33)45)63-39-37(51-17-31(55-39)23-15-53-59(19-23)25-7-11-49-12-8-25)57-65-41(61)42(62)66-58-38-40(64-22(2)34-28(44)4-6-30(48)36(34)46)56-32(18-52-38)24-16-54-60(20-24)26-9-13-50-14-10-26/h3-6,15-22,25-26,49-50H,7-14H2,1-2H3,(H,51,57)(H,52,58)/t21-,22-/m1/s1 |
| InChIKey | QNKZZBRGXJHFHK-FGZHOGPDSA-N |
| XLogP | 8.45 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.67 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|