C24H20F3N5O4S — CID 90304583
1,1,1-trifluoro-N-[2-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]ethyl]methanesulfonamide (PubChem CID 90304583) has the molecular formula C24H20F3N5O4S and a molecular weight of 531.52 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90304583 |
| Molecular Formula | C24H20F3N5O4S |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]ethyl]methanesulfonamide |
| SMILES | NNC(=O)c1cc(-c2ccc(-c3ccc(OCCNS(=O)(=O)C(F)(F)F)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C24H20F3N5O4S/c25-24(26,27)37(34,35)30-11-12-36-18-7-5-16(6-8-18)15-1-3-17(4-2-15)22-13-19(23(33)32-28)20-14-29-10-9-21(20)31-22/h1-10,13-14,30H,11-12,28H2,(H,32,33) |
| InChIKey | RFFKOBPMQBWBKQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|