About (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one
(3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one (PubChem CID 90304704) has the molecular formula C21H23F4NO2
and a molecular weight of 397.41 g/mol. Its IUPAC name is (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one.
Molecular Properties
| Compound Name | (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one |
| PubChem CID | 90304704 |
| Molecular Formula | C21H23F4NO2 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one |
| SMILES | Cc1ccc(C(=O)C[C@@](N)(c2ccc(OCCCCF)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F4NO2/c1-15-4-6-16(7-5-15)19(27)14-20(26,21(23,24)25)17-8-10-18(11-9-17)28-13-3-2-12-22/h4-11H,2-3,12-14,26H2,1H3/t20-/m1/s1 |
| InChIKey | GYTBYGWHSHZQBI-HXUWFJFHSA-N |
| XLogP | 5.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one?
The IUPAC name of (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one (CID 90304704) is (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one.
What is the SMILES notation for (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one?
The canonical SMILES for (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one is Cc1ccc(C(=O)C[C@@](N)(c2ccc(OCCCCF)cc2)C(F)(F)F)cc1.
What is the InChIKey of (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one?
The InChIKey is GYTBYGWHSHZQBI-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H23F4NO2/c1-15-4-6-16(7-5-15)19(27)14-20(26,21(23,24)25)17-8-10-18(11-9-17)28-13-3-2-12-22/h4-11H,2-3,12-14,26H2,1H3/t20-/m1/s1.
What are the key properties of (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one?
(3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one has a molecular weight of 397.41 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-4,4,4-trifluoro-3-[4-(4-fluorobutoxy)phenyl]-1-(4-methylphenyl)butan-1-one is sourced from PubChem (CID 90304704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).