About 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine
2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine (PubChem CID 90305213) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine.
Molecular Properties
| Compound Name | 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine |
| PubChem CID | 90305213 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine |
| SMILES | CC/C=C\C1=C(C)C=Cc2ccccc2N1C |
| InChI | InChI=1S/C16H19N/c1-4-5-9-15-13(2)11-12-14-8-6-7-10-16(14)17(15)3/h5-12H,4H2,1-3H3/b9-5- |
| InChIKey | MLKOPYCLRNTYBR-UITAMQMPSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine?
The IUPAC name of 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine (CID 90305213) is 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine.
What is the SMILES notation for 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine?
The canonical SMILES for 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine is CC/C=C\C1=C(C)C=Cc2ccccc2N1C.
What is the InChIKey of 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine?
The InChIKey is MLKOPYCLRNTYBR-UITAMQMPSA-N. The full InChI is InChI=1S/C16H19N/c1-4-5-9-15-13(2)11-12-14-8-6-7-10-16(14)17(15)3/h5-12H,4H2,1-3H3/b9-5-.
What are the key properties of 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine?
2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine has a molecular weight of 225.33 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-1-enyl]-1,3-dimethyl-1-benzazepine is sourced from PubChem (CID 90305213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).