C21H27N3 — CID 90305220
3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(2Z)-hexa-2,5-dienyl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole (PubChem CID 90305220) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(2Z)-hexa-2,5-dienyl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole.
| Compound Name | 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(2Z)-hexa-2,5-dienyl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 90305220 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(2Z)-hexa-2,5-dienyl]-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,2,4-triazole |
| SMILES | C=CC/C=C\Cn1c(/C=C/C=C\C=C/C)nnc1C(/C=C\C)=C/C |
| InChI | InChI=1S/C21H27N3/c1-5-9-11-13-14-17-20-22-23-21(19(8-4)16-7-3)24(20)18-15-12-10-6-2/h5-9,11-17H,2,10,18H2,1,3-4H3/b9-5-,13-11-,15-12-,16-7-,17-14+,19-8+ |
| InChIKey | VDBYMUKFQDTULD-SDHXGNPASA-N |
| XLogP | 5.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|