About 2-fluoro-6-methyl-1,2-dihydropyridine
2-fluoro-6-methyl-1,2-dihydropyridine (PubChem CID 90305541) has the molecular formula C6H8FN
and a molecular weight of 113.13 g/mol. Its IUPAC name is 2-fluoro-6-methyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-fluoro-6-methyl-1,2-dihydropyridine |
| PubChem CID | 90305541 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 2-fluoro-6-methyl-1,2-dihydropyridine |
| SMILES | CC1=CC=CC(F)N1 |
| InChI | InChI=1S/C6H8FN/c1-5-3-2-4-6(7)8-5/h2-4,6,8H,1H3 |
| InChIKey | WGPOATARDPYMDK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-methyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-methyl-1,2-dihydropyridine?
The IUPAC name of 2-fluoro-6-methyl-1,2-dihydropyridine (CID 90305541) is 2-fluoro-6-methyl-1,2-dihydropyridine.
What is the SMILES notation for 2-fluoro-6-methyl-1,2-dihydropyridine?
The canonical SMILES for 2-fluoro-6-methyl-1,2-dihydropyridine is CC1=CC=CC(F)N1.
What is the InChIKey of 2-fluoro-6-methyl-1,2-dihydropyridine?
The InChIKey is WGPOATARDPYMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN/c1-5-3-2-4-6(7)8-5/h2-4,6,8H,1H3.
What are the key properties of 2-fluoro-6-methyl-1,2-dihydropyridine?
2-fluoro-6-methyl-1,2-dihydropyridine has a molecular weight of 113.13 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-methyl-1,2-dihydropyridine is sourced from PubChem (CID 90305541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).