C13H19N3 — CID 90305870
3-tert-butyl-5-propyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 90305870) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-tert-butyl-5-propyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-tert-butyl-5-propyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 90305870 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-tert-butyl-5-propyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCCc1cccc2nnc(C(C)(C)C)n12 |
| InChI | InChI=1S/C13H19N3/c1-5-7-10-8-6-9-11-14-15-12(16(10)11)13(2,3)4/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | YPQPLEUGOCPWTO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |