C16H11N3O2 — CID 90305940
4-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]benzoic acid (PubChem CID 90305940) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]benzoic acid.
| Compound Name | 4-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 90305940 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C#Cc1nnc2ccccn12 |
| InChI | InChI=1S/C16H11N3O2/c1-11-5-6-13(16(20)21)10-12(11)7-8-15-18-17-14-4-2-3-9-19(14)15/h2-6,9-10H,1H3,(H,20,21) |
| InChIKey | ZADSNBLLEUPZRK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|