About 1-ethynyl-N,N-dimethylbenzimidazol-5-amine
1-ethynyl-N,N-dimethylbenzimidazol-5-amine (PubChem CID 90306015) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-ethynyl-N,N-dimethylbenzimidazol-5-amine.
Molecular Properties
| Compound Name | 1-ethynyl-N,N-dimethylbenzimidazol-5-amine |
| PubChem CID | 90306015 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-ethynyl-N,N-dimethylbenzimidazol-5-amine |
| SMILES | C#Cn1cnc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C11H11N3/c1-4-14-8-12-10-7-9(13(2)3)5-6-11(10)14/h1,5-8H,2-3H3 |
| InChIKey | ILLKWYLGYYXPME-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-N,N-dimethylbenzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-N,N-dimethylbenzimidazol-5-amine?
The IUPAC name of 1-ethynyl-N,N-dimethylbenzimidazol-5-amine (CID 90306015) is 1-ethynyl-N,N-dimethylbenzimidazol-5-amine.
What is the SMILES notation for 1-ethynyl-N,N-dimethylbenzimidazol-5-amine?
The canonical SMILES for 1-ethynyl-N,N-dimethylbenzimidazol-5-amine is C#Cn1cnc2cc(N(C)C)ccc21.
What is the InChIKey of 1-ethynyl-N,N-dimethylbenzimidazol-5-amine?
The InChIKey is ILLKWYLGYYXPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-4-14-8-12-10-7-9(13(2)3)5-6-11(10)14/h1,5-8H,2-3H3.
What are the key properties of 1-ethynyl-N,N-dimethylbenzimidazol-5-amine?
1-ethynyl-N,N-dimethylbenzimidazol-5-amine has a molecular weight of 185.23 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-N,N-dimethylbenzimidazol-5-amine is sourced from PubChem (CID 90306015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).