About [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide
[(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide (PubChem CID 90306101) has the molecular formula C14H12Cl2N4OS
and a molecular weight of 355.25 g/mol. Its IUPAC name is [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide.
Molecular Properties
| Compound Name | [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide |
| PubChem CID | 90306101 |
| Molecular Formula | C14H12Cl2N4OS |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide |
| SMILES | CSC(NC#N)Nc1cc(Cl)c(Oc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N4OS/c1-22-14(19-8-17)20-9-6-10(15)13(11(16)7-9)21-12-4-2-3-5-18-12/h2-7,14,19-20H,1H3 |
| InChIKey | WIPFBDWQCNRFMS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide?
The IUPAC name of [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide (CID 90306101) is [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide.
What is the SMILES notation for [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide?
The canonical SMILES for [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide is CSC(NC#N)Nc1cc(Cl)c(Oc2ccccn2)c(Cl)c1.
What is the InChIKey of [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide?
The InChIKey is WIPFBDWQCNRFMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N4OS/c1-22-14(19-8-17)20-9-6-10(15)13(11(16)7-9)21-12-4-2-3-5-18-12/h2-7,14,19-20H,1H3.
What are the key properties of [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide?
[(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide has a molecular weight of 355.25 g/mol, XLogP of 4.31, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dichloro-4-pyridin-2-yloxyanilino)-methylsulfanylmethyl]cyanamide is sourced from PubChem (CID 90306101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).