About (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate
(2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate (PubChem CID 90306695) has the molecular formula C17H21N3O8
and a molecular weight of 395.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate |
| PubChem CID | 90306695 |
| Molecular Formula | C17H21N3O8 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H21N3O8/c21-12(6-9-19-13(22)2-3-14(19)23)18-8-1-10-27-11-7-17(26)28-20-15(24)4-5-16(20)25/h2-3H,1,4-11H2,(H,18,21) |
| InChIKey | FHLPIJOCAYLMKD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate (CID 90306695) is (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate is O=C(CCN1C(=O)C=CC1=O)NCCCOCCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate?
The InChIKey is FHLPIJOCAYLMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O8/c21-12(6-9-19-13(22)2-3-14(19)23)18-8-1-10-27-11-7-17(26)28-20-15(24)4-5-16(20)25/h2-3H,1,4-11H2,(H,18,21).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate?
(2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate has a molecular weight of 395.37 g/mol, XLogP of -1.18, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 3-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]propanoate is sourced from PubChem (CID 90306695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).