C13H24O — CID 90307120
(3R)-3-(2-methoxyethyl)-3,4,4-trimethylhepta-1,6-diene (PubChem CID 90307120) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (3R)-3-(2-methoxyethyl)-3,4,4-trimethylhepta-1,6-diene.
| Compound Name | (3R)-3-(2-methoxyethyl)-3,4,4-trimethylhepta-1,6-diene |
|---|---|
| PubChem CID | 90307120 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (3R)-3-(2-methoxyethyl)-3,4,4-trimethylhepta-1,6-diene |
| SMILES | C=CCC(C)(C)[C@@](C)(C=C)CCOC |
| InChI | InChI=1S/C13H24O/c1-7-9-12(3,4)13(5,8-2)10-11-14-6/h7-8H,1-2,9-11H2,3-6H3/t13-/m0/s1 |
| InChIKey | YTTDVTALYCGDIH-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|