C17H24N2O3S — CID 90307393
(4aR,6S,11bR)-2,3,3,6,11b-pentamethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[4,5-b][1,4]thiazin-10-amine (PubChem CID 90307393) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (4aR,6S,11bR)-2,3,3,6,11b-pentamethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[4,5-b][1,4]thiazin-10-amine.
| Compound Name | (4aR,6S,11bR)-2,3,3,6,11b-pentamethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[4,5-b][1,4]thiazin-10-amine |
|---|---|
| PubChem CID | 90307393 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (4aR,6S,11bR)-2,3,3,6,11b-pentamethyl-4,4-dioxo-5,6-dihydro-4aH-[1]benzoxepino[4,5-b][1,4]thiazin-10-amine |
| SMILES | CC1=N[C@]2(C)c3cc(N)ccc3O[C@@H](C)C[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C17H24N2O3S/c1-10-8-15-17(5,13-9-12(18)6-7-14(13)22-10)19-11(2)16(3,4)23(15,20)21/h6-7,9-10,15H,8,18H2,1-5H3/t10-,15+,17+/m0/s1 |
| InChIKey | YIFSCQCUOQDRDG-UDTVLSCZSA-N |
| XLogP | 2.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|