C19H20F5N5O — CID 90308188
[(2S,4R)-1,1,1,5-tetrafluoro-4-[2-fluoro-5-[5-(N'-methylcarbamimidoyl)-3-pyridinyl]phenyl]pentan-2-yl] carbamimidate (PubChem CID 90308188) has the molecular formula C19H20F5N5O and a molecular weight of 429.39 g/mol. Its IUPAC name is [(2S,4R)-1,1,1,5-tetrafluoro-4-[2-fluoro-5-[5-(N'-methylcarbamimidoyl)-3-pyridinyl]phenyl]pentan-2-yl] carbamimidate.
| Compound Name | [(2S,4R)-1,1,1,5-tetrafluoro-4-[2-fluoro-5-[5-(N'-methylcarbamimidoyl)-3-pyridinyl]phenyl]pentan-2-yl] carbamimidate |
|---|---|
| PubChem CID | 90308188 |
| Molecular Formula | C19H20F5N5O |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [(2S,4R)-1,1,1,5-tetrafluoro-4-[2-fluoro-5-[5-(N'-methylcarbamimidoyl)-3-pyridinyl]phenyl]pentan-2-yl] carbamimidate |
| SMILES | [H]/N=C(\N)O[C@@H](C[C@@H](CF)c1cc(-c2cncc(/C(N)=N/C)c2)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C19H20F5N5O/c1-28-17(25)13-4-12(8-29-9-13)10-2-3-15(21)14(5-10)11(7-20)6-16(19(22,23)24)30-18(26)27/h2-5,8-9,11,16H,6-7H2,1H3,(H2,25,28)(H3,26,27)/t11-,16-/m0/s1 |
| InChIKey | VXVIIBKGQKFXQI-ZBEGNZNMSA-N |
| XLogP | 3.51 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|