About 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane
2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane (PubChem CID 90308316) has the molecular formula C13H28O3
and a molecular weight of 232.36 g/mol. Its IUPAC name is 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane.
Molecular Properties
| Compound Name | 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane |
| PubChem CID | 90308316 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane |
| SMILES | COC(C)(C)C(C(C)(C)OC)C(C)(C)OC |
| InChI | InChI=1S/C13H28O3/c1-11(2,14-7)10(12(3,4)15-8)13(5,6)16-9/h10H,1-9H3 |
| InChIKey | OBAIUHUCGUKOSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane?
The IUPAC name of 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane (CID 90308316) is 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane.
What is the SMILES notation for 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane?
The canonical SMILES for 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane is COC(C)(C)C(C(C)(C)OC)C(C)(C)OC.
What is the InChIKey of 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane?
The InChIKey is OBAIUHUCGUKOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3/c1-11(2,14-7)10(12(3,4)15-8)13(5,6)16-9/h10H,1-9H3.
What are the key properties of 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane?
2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane has a molecular weight of 232.36 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-3-(2-methoxypropan-2-yl)-2,4-dimethylpentane is sourced from PubChem (CID 90308316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).