C9H15NS — CID 90308460
(Z)-2-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)prop-1-ene-1-thiol (PubChem CID 90308460) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (Z)-2-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)prop-1-ene-1-thiol.
| Compound Name | (Z)-2-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)prop-1-ene-1-thiol |
|---|---|
| PubChem CID | 90308460 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (Z)-2-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)prop-1-ene-1-thiol |
| SMILES | CC1=C(/C(C)=C\S)CCNC1 |
| InChI | InChI=1S/C9H15NS/c1-7-5-10-4-3-9(7)8(2)6-11/h6,10-11H,3-5H2,1-2H3/b8-6- |
| InChIKey | GRMCMVNJJDTEFT-VURMDHGXSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|