About N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide (PubChem CID 90308543) has the molecular formula C12H10ClF3N4O
and a molecular weight of 318.69 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide |
| PubChem CID | 90308543 |
| Molecular Formula | C12H10ClF3N4O |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C12H10ClF3N4O/c13-11-9(18-10(21)3-4-12(14,15)16)7-20(19-11)8-2-1-5-17-6-8/h1-2,5-7H,3-4H2,(H,18,21) |
| InChIKey | LWFQRGGNZHRUNL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide?
The IUPAC name of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide (CID 90308543) is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide?
The canonical SMILES for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide is O=C(CCC(F)(F)F)Nc1cn(-c2cccnc2)nc1Cl.
What is the InChIKey of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide?
The InChIKey is LWFQRGGNZHRUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClF3N4O/c13-11-9(18-10(21)3-4-12(14,15)16)7-20(19-11)8-2-1-5-17-6-8/h1-2,5-7H,3-4H2,(H,18,21).
What are the key properties of N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide?
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide has a molecular weight of 318.69 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluorobutanamide is sourced from PubChem (CID 90308543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).