C20H24F3N9O — CID 90308778
3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[7-methyl-2-(2,2,2-trifluoroethyl)indazol-5-yl]amino]-1,2,4-triazine-6-carboxamide (PubChem CID 90308778) has the molecular formula C20H24F3N9O and a molecular weight of 463.47 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[7-methyl-2-(2,2,2-trifluoroethyl)indazol-5-yl]amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[7-methyl-2-(2,2,2-trifluoroethyl)indazol-5-yl]amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 90308778 |
| Molecular Formula | C20H24F3N9O |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[7-methyl-2-(2,2,2-trifluoroethyl)indazol-5-yl]amino]-1,2,4-triazine-6-carboxamide |
| SMILES | Cc1cc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)nnc2C(N)=O)cc2cn(CC(F)(F)F)nc12 |
| InChI | InChI=1S/C20H24F3N9O/c1-10-6-12(7-11-8-32(31-15(10)11)9-20(21,22)23)26-18-16(17(25)33)29-30-19(28-18)27-14-5-3-2-4-13(14)24/h6-8,13-14H,2-5,9,24H2,1H3,(H2,25,33)(H2,26,27,28,30)/t13-,14+/m0/s1 |
| InChIKey | DEKTXPBQWZCOIH-UONOGXRCSA-N |
| XLogP | 2.62 |
| TPSA | 149.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |