C27H44O7 — CID 90309507
(Z)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl]octadec-9-enoic acid (PubChem CID 90309507) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is (Z)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl]octadec-9-enoic acid.
| Compound Name | (Z)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl]octadec-9-enoic acid |
|---|---|
| PubChem CID | 90309507 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (Z)-2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-5-oxo-2H-furan-4-yl]octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C(=O)O)C1=C(O)C(C2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C27H44O7/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(25(29)30)22-23(28)24(33-26(22)31)21-19-32-27(2,3)34-21/h11-12,20-21,24,28H,4-10,13-19H2,1-3H3,(H,29,30)/b12-11- |
| InChIKey | GMSKBUWQBHJOIW-QXMHVHEDSA-N |
| XLogP | 6.22 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|