C40H25F3N4O3S — CID 90310257
[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazol-2-yl] trifluoromethanesulfonate (PubChem CID 90310257) has the molecular formula C40H25F3N4O3S and a molecular weight of 698.73 g/mol. Its IUPAC name is [9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazol-2-yl] trifluoromethanesulfonate.
| Compound Name | [9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazol-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90310257 |
| Molecular Formula | C40H25F3N4O3S |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | [9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazol-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cc1-c1ccccc1)c1ccccc1n2-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1)C(F)(F)F |
| InChI | InChI=1S/C40H25F3N4O3S/c41-40(42,43)51(48,49)50-36-25-35-33(24-32(36)26-13-4-1-5-14-26)31-21-10-11-22-34(31)47(35)30-20-12-19-29(23-30)39-45-37(27-15-6-2-7-16-27)44-38(46-39)28-17-8-3-9-18-28/h1-25H |
| InChIKey | JKJYZFDYODIQTA-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|