About 4,7-ditert-butyl-3,4-dihydro-1H-isochromene
4,7-ditert-butyl-3,4-dihydro-1H-isochromene (PubChem CID 90310317) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 4,7-ditert-butyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 4,7-ditert-butyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 90310317 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 4,7-ditert-butyl-3,4-dihydro-1H-isochromene |
| SMILES | CC(C)(C)c1ccc2c(c1)COCC2C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-16(2,3)13-7-8-14-12(9-13)10-18-11-15(14)17(4,5)6/h7-9,15H,10-11H2,1-6H3 |
| InChIKey | LXTVIBLWNONTHZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,7-ditert-butyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-ditert-butyl-3,4-dihydro-1H-isochromene?
The IUPAC name of 4,7-ditert-butyl-3,4-dihydro-1H-isochromene (CID 90310317) is 4,7-ditert-butyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 4,7-ditert-butyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for 4,7-ditert-butyl-3,4-dihydro-1H-isochromene is CC(C)(C)c1ccc2c(c1)COCC2C(C)(C)C.
What is the InChIKey of 4,7-ditert-butyl-3,4-dihydro-1H-isochromene?
The InChIKey is LXTVIBLWNONTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-16(2,3)13-7-8-14-12(9-13)10-18-11-15(14)17(4,5)6/h7-9,15H,10-11H2,1-6H3.
What are the key properties of 4,7-ditert-butyl-3,4-dihydro-1H-isochromene?
4,7-ditert-butyl-3,4-dihydro-1H-isochromene has a molecular weight of 246.39 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-ditert-butyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 90310317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).