About 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole
4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole (PubChem CID 90310340) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole |
| PubChem CID | 90310340 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole |
| SMILES | CC(C)C1=C(C(C)C)C2=CC=NC2=N1 |
| InChI | InChI=1S/C12H16N2/c1-7(2)10-9-5-6-13-12(9)14-11(10)8(3)4/h5-8H,1-4H3 |
| InChIKey | YCMACCSSWWMNPA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole?
The IUPAC name of 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole (CID 90310340) is 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole.
What is the SMILES notation for 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole?
The canonical SMILES for 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole is CC(C)C1=C(C(C)C)C2=CC=NC2=N1.
What is the InChIKey of 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole?
The InChIKey is YCMACCSSWWMNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-7(2)10-9-5-6-13-12(9)14-11(10)8(3)4/h5-8H,1-4H3.
What are the key properties of 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole?
4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole has a molecular weight of 188.27 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)pyrrolo[2,3-b]pyrrole is sourced from PubChem (CID 90310340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).